C28H30N5S+ — CID 123409808
4-[1-[1-[6-(4,5-dihydro-1H-imidazol-5-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]quinolin-1-ium-5-yl]ethyl]-1,3-dihydroimidazole-2-thione (PubChem CID 123409808) has the molecular formula C28H30N5S+ and a molecular weight of 468.65 g/mol. Its IUPAC name is 4-[1-[1-[6-(4,5-dihydro-1H-imidazol-5-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]quinolin-1-ium-5-yl]ethyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[1-[1-[6-(4,5-dihydro-1H-imidazol-5-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]quinolin-1-ium-5-yl]ethyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 123409808 |
| Molecular Formula | C28H30N5S+ |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 4-[1-[1-[6-(4,5-dihydro-1H-imidazol-5-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]quinolin-1-ium-5-yl]ethyl]-1,3-dihydroimidazole-2-thione |
| SMILES | CC(c1c[nH]c(=S)[nH]1)c1cccc2c1ccc[n+]2-c1ccc2c(c1)CCC(CC1CN=CN1)C2 |
| InChI | InChI=1S/C28H29N5S/c1-18(26-16-30-28(34)32-26)24-4-2-6-27-25(24)5-3-11-33(27)23-10-9-20-12-19(7-8-21(20)14-23)13-22-15-29-17-31-22/h2-6,9-11,14,16-19,22H,7-8,12-13,15H2,1H3,(H2-,29,30,31,32,34)/p+1 |
| InChIKey | RGHYUMBTQPLUSE-UHFFFAOYSA-O |
| XLogP | 5.15 |
| TPSA | 59.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|