C22H22Cl2F3N3O2S — CID 123410189
N'-[1-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]imino-1-methylsulfonylbutan-2-yl]methanimidamide (PubChem CID 123410189) has the molecular formula C22H22Cl2F3N3O2S and a molecular weight of 520.40 g/mol. Its IUPAC name is N'-[1-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]imino-1-methylsulfonylbutan-2-yl]methanimidamide.
| Compound Name | N'-[1-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]imino-1-methylsulfonylbutan-2-yl]methanimidamide |
|---|---|
| PubChem CID | 123410189 |
| Molecular Formula | C22H22Cl2F3N3O2S |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | N'-[1-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]imino-1-methylsulfonylbutan-2-yl]methanimidamide |
| SMILES | CCC(/N=C/N)/C(=N\c1ccc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H22Cl2F3N3O2S/c1-3-20(29-13-28)21(33(2,31)32)30-18-7-4-14(5-8-18)6-9-19(22(25,26)27)15-10-16(23)12-17(24)11-15/h4-13,19-20H,3H2,1-2H3,(H2,28,29)/b9-6?,30-21+ |
| InChIKey | ZQLHWQWQTMRCFW-VHPMTFJFSA-N |
| XLogP | 6.19 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|