C23H17Cl2F3N4 — CID 134217870
N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-pyridin-4-ylphenyl]methanimidamide (PubChem CID 134217870) has the molecular formula C23H17Cl2F3N4 and a molecular weight of 477.32 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-pyridin-4-ylphenyl]methanimidamide.
| Compound Name | N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-pyridin-4-ylphenyl]methanimidamide |
|---|---|
| PubChem CID | 134217870 |
| Molecular Formula | C23H17Cl2F3N4 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-(aminomethylidene)-N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-pyridin-4-ylphenyl]methanimidamide |
| SMILES | N/C=N/C=N/c1ccc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1-c1ccncc1 |
| InChI | InChI=1S/C23H17Cl2F3N4/c24-18-10-17(11-19(25)12-18)21(23(26,27)28)3-1-15-2-4-22(32-14-31-13-29)20(9-15)16-5-7-30-8-6-16/h1-14,21H,(H2,29,31,32)/b3-1+ |
| InChIKey | YQFIGLVVHVWPHX-HNQUOIGGSA-N |
| XLogP | 7.06 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|