C21H19ClF3N5 — CID 134225562
N'-[4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide (PubChem CID 134225562) has the molecular formula C21H19ClF3N5 and a molecular weight of 433.87 g/mol. Its IUPAC name is N'-[4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide.
| Compound Name | N'-[4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide |
|---|---|
| PubChem CID | 134225562 |
| Molecular Formula | C21H19ClF3N5 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N'-[4-[(E)-3-(4-chloro-3,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide |
| SMILES | Cc1cc(C(/C=C/c2ccc(/N=C/N=C(N)N)c(C#N)c2)C(F)(F)F)cc(C)c1Cl |
| InChI | InChI=1S/C21H19ClF3N5/c1-12-7-15(8-13(2)19(12)22)17(21(23,24)25)5-3-14-4-6-18(16(9-14)10-26)29-11-30-20(27)28/h3-9,11,17H,1-2H3,(H4,27,28,29,30)/b5-3+ |
| InChIKey | MCTMYTAYLNYZIB-HWKANZROSA-N |
| XLogP | 5.12 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|