C19H16Cl2F3N3 — CID 123615633
N-(aminomethylidene)-N'-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]ethanimidamide (PubChem CID 123615633) has the molecular formula C19H16Cl2F3N3 and a molecular weight of 414.26 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]ethanimidamide.
| Compound Name | N-(aminomethylidene)-N'-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 123615633 |
| Molecular Formula | C19H16Cl2F3N3 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-(aminomethylidene)-N'-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]ethanimidamide |
| SMILES | CC(/N=C/N)=N\c1ccc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16Cl2F3N3/c1-12(26-11-25)27-17-5-2-13(3-6-17)4-7-18(19(22,23)24)14-8-15(20)10-16(21)9-14/h2-11,18H,1H3,(H2,25,26,27) |
| InChIKey | AHQASRCHWAAFII-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|