C22H18Cl2F3N3 — CID 134222230
5-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-[ethenyl-(propan-2-ylideneamino)amino]benzonitrile (PubChem CID 134222230) has the molecular formula C22H18Cl2F3N3 and a molecular weight of 452.31 g/mol. Its IUPAC name is 5-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-[ethenyl-(propan-2-ylideneamino)amino]benzonitrile.
| Compound Name | 5-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-[ethenyl-(propan-2-ylideneamino)amino]benzonitrile |
|---|---|
| PubChem CID | 134222230 |
| Molecular Formula | C22H18Cl2F3N3 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 5-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-[ethenyl-(propan-2-ylideneamino)amino]benzonitrile |
| SMILES | C=CN(N=C(C)C)c1ccc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C22H18Cl2F3N3/c1-4-30(29-14(2)3)21-8-6-15(9-17(21)13-28)5-7-20(22(25,26)27)16-10-18(23)12-19(24)11-16/h4-12,20H,1H2,2-3H3/b7-5+ |
| InChIKey | RANCOSRTXVLEKH-FNORWQNLSA-N |
| XLogP | 7.57 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|