C19H11Cl3F3N5O2 — CID 138701963
N'-[[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-1-nitro-N-oxido-N-oxomethanimidamide (PubChem CID 138701963) has the molecular formula C19H11Cl3F3N5O2 and a molecular weight of 504.68 g/mol. Its IUPAC name is N'-[[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-1-nitro-N-oxido-N-oxomethanimidamide.
| Compound Name | N'-[[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-1-nitro-N-oxido-N-oxomethanimidamide |
|---|---|
| PubChem CID | 138701963 |
| Molecular Formula | C19H11Cl3F3N5O2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | N'-[[2-cyano-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-1-nitro-N-oxido-N-oxomethanimidamide |
| SMILES | N#Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1/N=C/N=C(\N)[N+](=O)[O-] |
| InChI | InChI=1S/C19H11Cl3F3N5O2/c20-14-6-11(7-15(21)17(14)22)13(19(23,24)25)3-1-10-2-4-16(12(5-10)8-26)28-9-29-18(27)30(31)32/h1-7,9,13H,(H2,27,28,29)/b3-1+ |
| InChIKey | LZVIXHWCCOZNCW-HNQUOIGGSA-N |
| XLogP | 6.13 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|