C22H20Cl3F3N4 — CID 144653115
N'-[1-[2-cyano-6-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]propyl]methanimidamide (PubChem CID 144653115) has the molecular formula C22H20Cl3F3N4 and a molecular weight of 503.78 g/mol. Its IUPAC name is N'-[1-[2-cyano-6-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]propyl]methanimidamide.
| Compound Name | N'-[1-[2-cyano-6-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]propyl]methanimidamide |
|---|---|
| PubChem CID | 144653115 |
| Molecular Formula | C22H20Cl3F3N4 |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | N'-[1-[2-cyano-6-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]propyl]methanimidamide |
| SMILES | CCC(/N=C\N)Nc1c(C)cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C22H20Cl3F3N4/c1-3-19(31-11-30)32-21-12(2)6-13(7-15(21)10-29)4-5-16(22(26,27)28)14-8-17(23)20(25)18(24)9-14/h4-9,11,16,19,32H,3H2,1-2H3,(H2,30,31)/b5-4+ |
| InChIKey | RRVHDDYICCEYHL-SNAWJCMRSA-N |
| XLogP | 7.32 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|