C16H27NO3 — CID 123412169
(9R,10S,11R)-10-hydroxy-9-(hydroxymethyl)-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 123412169) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (9R,10S,11R)-10-hydroxy-9-(hydroxymethyl)-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (9R,10S,11R)-10-hydroxy-9-(hydroxymethyl)-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 123412169 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (9R,10S,11R)-10-hydroxy-9-(hydroxymethyl)-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | CC1=C[C@@H](C)[C@H](O)[C@@H](CO)C=CCCCCC(=O)NC1 |
| InChI | InChI=1S/C16H27NO3/c1-12-9-13(2)16(20)14(11-18)7-5-3-4-6-8-15(19)17-10-12/h5,7,9,13-14,16,18,20H,3-4,6,8,10-11H2,1-2H3,(H,17,19)/t13-,14-,16+/m1/s1 |
| InChIKey | AMYZFESNFVNDJL-FMKPAKJESA-N |
| XLogP | 1.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|