C11H17N3 — CID 123412705
4-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4,5-dihydrotriazole (PubChem CID 123412705) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 4-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4,5-dihydrotriazole.
| Compound Name | 4-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4,5-dihydrotriazole |
|---|---|
| PubChem CID | 123412705 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 4-methyl-1-(4-methylhepta-1,3,5-trien-2-yl)-4,5-dihydrotriazole |
| SMILES | C=C(C=C(C)C=CC)N1CC(C)N=N1 |
| InChI | InChI=1S/C11H17N3/c1-5-6-9(2)7-11(4)14-8-10(3)12-13-14/h5-7,10H,4,8H2,1-3H3 |
| InChIKey | MRROBETZRYZVCV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|