C12H18N2 — CID 123416281
8-ethyl-1,5-dimethyl-7,8-dihydro-2H-1,6-naphthyridine (PubChem CID 123416281) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 8-ethyl-1,5-dimethyl-7,8-dihydro-2H-1,6-naphthyridine.
| Compound Name | 8-ethyl-1,5-dimethyl-7,8-dihydro-2H-1,6-naphthyridine |
|---|---|
| PubChem CID | 123416281 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 8-ethyl-1,5-dimethyl-7,8-dihydro-2H-1,6-naphthyridine |
| SMILES | CCC1CN=C(C)C2=C1N(C)CC=C2 |
| InChI | InChI=1S/C12H18N2/c1-4-10-8-13-9(2)11-6-5-7-14(3)12(10)11/h5-6,10H,4,7-8H2,1-3H3 |
| InChIKey | LHDBCAYBMZXMRY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |