C19H16N4 — CID 123420361
N-(4,6-diphenyl-1,3,5-triazin-2-yl)but-3-en-2-imine (PubChem CID 123420361) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is N-(4,6-diphenyl-1,3,5-triazin-2-yl)but-3-en-2-imine.
| Compound Name | N-(4,6-diphenyl-1,3,5-triazin-2-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 123420361 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(4,6-diphenyl-1,3,5-triazin-2-yl)but-3-en-2-imine |
| SMILES | C=CC(C)=Nc1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H16N4/c1-3-14(2)20-19-22-17(15-10-6-4-7-11-15)21-18(23-19)16-12-8-5-9-13-16/h3-13H,1H2,2H3 |
| InChIKey | IICBKRDMJPPKHQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|