C23H22N4O — CID 144914672
(3E)-4-[(4,6-diphenyl-1,3,5-triazin-2-yl)-prop-1-en-2-ylamino]penta-1,3-dien-2-ol (PubChem CID 144914672) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is (3E)-4-[(4,6-diphenyl-1,3,5-triazin-2-yl)-prop-1-en-2-ylamino]penta-1,3-dien-2-ol.
| Compound Name | (3E)-4-[(4,6-diphenyl-1,3,5-triazin-2-yl)-prop-1-en-2-ylamino]penta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 144914672 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3E)-4-[(4,6-diphenyl-1,3,5-triazin-2-yl)-prop-1-en-2-ylamino]penta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C(\C)N(C(=C)C)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H22N4O/c1-16(2)27(17(3)15-18(4)28)23-25-21(19-11-7-5-8-12-19)24-22(26-23)20-13-9-6-10-14-20/h5-15,28H,1,4H2,2-3H3/b17-15+ |
| InChIKey | CBYLWLQGIWITIL-BMRADRMJSA-N |
| XLogP | 5.52 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|