C25H22 — CID 123440428
9-(6-methyl-2,3-dimethylidenehepta-4,6-dienylidene)-10-methylidenephenanthrene (PubChem CID 123440428) has the molecular formula C25H22 and a molecular weight of 322.45 g/mol. Its IUPAC name is 9-(6-methyl-2,3-dimethylidenehepta-4,6-dienylidene)-10-methylidenephenanthrene.
| Compound Name | 9-(6-methyl-2,3-dimethylidenehepta-4,6-dienylidene)-10-methylidenephenanthrene |
|---|---|
| PubChem CID | 123440428 |
| Molecular Formula | C25H22 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 9-(6-methyl-2,3-dimethylidenehepta-4,6-dienylidene)-10-methylidenephenanthrene |
| SMILES | C=C(C)C=CC(=C)C(=C)C=c1c(=C)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C25H22/c1-17(2)14-15-18(3)19(4)16-25-20(5)21-10-6-7-11-22(21)23-12-8-9-13-24(23)25/h6-16H,1,3-5H2,2H3 |
| InChIKey | SZXWFXRAUQQHOD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|