C18H17Cl — CID 143782740
2-chloro-3-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,4-dimethylidenenaphthalene (PubChem CID 143782740) has the molecular formula C18H17Cl and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-chloro-3-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,4-dimethylidenenaphthalene.
| Compound Name | 2-chloro-3-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,4-dimethylidenenaphthalene |
|---|---|
| PubChem CID | 143782740 |
| Molecular Formula | C18H17Cl |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-chloro-3-[(1E)-2,3-dimethylbuta-1,3-dienyl]-1,4-dimethylidenenaphthalene |
| SMILES | C=C(C)/C(C)=C/c1c(Cl)c(=C)c2ccccc2c1=C |
| InChI | InChI=1S/C18H17Cl/c1-11(2)12(3)10-17-13(4)15-8-6-7-9-16(15)14(5)18(17)19/h6-10H,1,4-5H2,2-3H3/b12-10+ |
| InChIKey | GILWNOBFUYIXFA-ZRDIBKRKSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|