C27H32Cl3NO2S — CID 123440696
4-(1-tert-butylsulfanylbutan-2-yl)-5-(4-chlorophenyl)-6-(3,5-dichlorophenyl)-2-prop-2-enylmorpholin-3-one (PubChem CID 123440696) has the molecular formula C27H32Cl3NO2S and a molecular weight of 540.98 g/mol. Its IUPAC name is 4-(1-tert-butylsulfanylbutan-2-yl)-5-(4-chlorophenyl)-6-(3,5-dichlorophenyl)-2-prop-2-enylmorpholin-3-one.
| Compound Name | 4-(1-tert-butylsulfanylbutan-2-yl)-5-(4-chlorophenyl)-6-(3,5-dichlorophenyl)-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 123440696 |
| Molecular Formula | C27H32Cl3NO2S |
| Molecular Weight | 540.98 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 4-(1-tert-butylsulfanylbutan-2-yl)-5-(4-chlorophenyl)-6-(3,5-dichlorophenyl)-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CCC1OC(c2cc(Cl)cc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)CSC(C)(C)C)C1=O |
| InChI | InChI=1S/C27H32Cl3NO2S/c1-6-8-23-26(32)31(22(7-2)16-34-27(3,4)5)24(17-9-11-19(28)12-10-17)25(33-23)18-13-20(29)15-21(30)14-18/h6,9-15,22-25H,1,7-8,16H2,2-5H3 |
| InChIKey | VFLZSUYZPYAMPN-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.98 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|