C25H44O4 — CID 123451938
(2-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,4,4-trimethyl-2-propan-2-ylpentanoate (PubChem CID 123451938) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (2-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,4,4-trimethyl-2-propan-2-ylpentanoate.
| Compound Name | (2-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123451938 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (2-cyclohexyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C)(CC(C)(C)C)C(=O)OCC1CCC2OC(C3CCCCC3)OC2C1 |
| InChI | InChI=1S/C25H44O4/c1-17(2)25(6,16-24(3,4)5)23(26)27-15-18-12-13-20-21(14-18)29-22(28-20)19-10-8-7-9-11-19/h17-22H,7-16H2,1-6H3 |
| InChIKey | AHNDDFUYBUUJAE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |