C22H37NO5Si — CID 123453143
benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-1-(2,2,5-trimethyl-1,3-dioxolan-4-yl)ethyl]carbamate (PubChem CID 123453143) has the molecular formula C22H37NO5Si and a molecular weight of 423.63 g/mol. Its IUPAC name is benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-1-(2,2,5-trimethyl-1,3-dioxolan-4-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-1-(2,2,5-trimethyl-1,3-dioxolan-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 123453143 |
| Molecular Formula | C22H37NO5Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-1-(2,2,5-trimethyl-1,3-dioxolan-4-yl)ethyl]carbamate |
| SMILES | CC1OC(C)(C)OC1C(CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H37NO5Si/c1-16-19(28-22(5,6)27-16)18(15-26-29(7,8)21(2,3)4)23-20(24)25-14-17-12-10-9-11-13-17/h9-13,16,18-19H,14-15H2,1-8H3,(H,23,24) |
| InChIKey | RZEYPGBKDBHZOD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|