C19H25BrF3N — CID 123472118
4-(4-bromophenyl)-5-ethyl-1,1,1-trifluoro-N,8-dimethylnon-3-en-2-imine (PubChem CID 123472118) has the molecular formula C19H25BrF3N and a molecular weight of 404.31 g/mol. Its IUPAC name is 4-(4-bromophenyl)-5-ethyl-1,1,1-trifluoro-N,8-dimethylnon-3-en-2-imine.
| Compound Name | 4-(4-bromophenyl)-5-ethyl-1,1,1-trifluoro-N,8-dimethylnon-3-en-2-imine |
|---|---|
| PubChem CID | 123472118 |
| Molecular Formula | C19H25BrF3N |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-(4-bromophenyl)-5-ethyl-1,1,1-trifluoro-N,8-dimethylnon-3-en-2-imine |
| SMILES | CCC(CCC(C)C)C(=C/C(=N/C)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H25BrF3N/c1-5-14(7-6-13(2)3)17(12-18(24-4)19(21,22)23)15-8-10-16(20)11-9-15/h8-14H,5-7H2,1-4H3/b17-12?,24-18- |
| InChIKey | WESYUFUKHRBNBV-OYASABQHSA-N |
| XLogP | 6.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|