C15H13Cl2N2O3PS — CID 123474633
[1H-benzimidazol-2-yl-(2,6-dichloro-3-methylphenyl)-sulfanylmethyl]phosphonic acid (PubChem CID 123474633) has the molecular formula C15H13Cl2N2O3PS and a molecular weight of 403.23 g/mol. Its IUPAC name is [1H-benzimidazol-2-yl-(2,6-dichloro-3-methylphenyl)-sulfanylmethyl]phosphonic acid.
| Compound Name | [1H-benzimidazol-2-yl-(2,6-dichloro-3-methylphenyl)-sulfanylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 123474633 |
| Molecular Formula | C15H13Cl2N2O3PS |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | [1H-benzimidazol-2-yl-(2,6-dichloro-3-methylphenyl)-sulfanylmethyl]phosphonic acid |
| SMILES | Cc1ccc(Cl)c(C(S)(c2nc3ccccc3[nH]2)P(=O)(O)O)c1Cl |
| InChI | InChI=1S/C15H13Cl2N2O3PS/c1-8-6-7-9(16)12(13(8)17)15(24,23(20,21)22)14-18-10-4-2-3-5-11(10)19-14/h2-7,24H,1H3,(H,18,19)(H2,20,21,22) |
| InChIKey | VPSWLXCHFAALNW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|