C32H45F6O8S2- — CID 123474972
2-(1-adamantyl)propan-2-yl 2,2-dimethylbutanoate;3-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 123474972) has the molecular formula C32H45F6O8S2- and a molecular weight of 735.83 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 2,2-dimethylbutanoate;3-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 2,2-dimethylbutanoate;3-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 123474972 |
| Molecular Formula | C32H45F6O8S2- |
| Molecular Weight | 735.83 g/mol |
| Exact Mass | 735.25 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 2,2-dimethylbutanoate;3-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)C12CC3CC(CC(C3)C1)C2.CCC(C)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C19H32O2.C13H14F6O6S2/c1-6-17(2,3)16(20)21-18(4,5)19-10-13-7-14(11-19)9-15(8-13)12-19;1-3-8(2)9-4-6-10(7-5-9)25-27(23,24)13(18,19)11(14,15)12(16,17)26(20,21)22/h13-15H,6-12H2,1-5H3;4-8H,3H2,1-2H3,(H,20,21,22)/p-1 |
| InChIKey | ANPHTJOOXVTFDK-UHFFFAOYSA-M |
| XLogP | 8.24 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.83 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|