C16H34S — CID 123486036
2,2,4,4,7-pentamethyl-6-propan-2-ylsulfanyloctane (PubChem CID 123486036) has the molecular formula C16H34S and a molecular weight of 258.51 g/mol. Its IUPAC name is 2,2,4,4,7-pentamethyl-6-propan-2-ylsulfanyloctane.
| Compound Name | 2,2,4,4,7-pentamethyl-6-propan-2-ylsulfanyloctane |
|---|---|
| PubChem CID | 123486036 |
| Molecular Formula | C16H34S |
| Molecular Weight | 258.51 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2,2,4,4,7-pentamethyl-6-propan-2-ylsulfanyloctane |
| SMILES | CC(C)SC(CC(C)(C)CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H34S/c1-12(2)14(17-13(3)4)10-16(8,9)11-15(5,6)7/h12-14H,10-11H2,1-9H3 |
| InChIKey | LIFGNFRSAIVLDX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |