C16H12F6N3O2+ — CID 123498082
1-[8-(trifluoromethyl)-4,7-diaza-1-azoniabicyclo[4.2.0]octa-1(8),6-dien-4-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione (PubChem CID 123498082) has the molecular formula C16H12F6N3O2+ and a molecular weight of 392.28 g/mol. Its IUPAC name is 1-[8-(trifluoromethyl)-4,7-diaza-1-azoniabicyclo[4.2.0]octa-1(8),6-dien-4-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione.
| Compound Name | 1-[8-(trifluoromethyl)-4,7-diaza-1-azoniabicyclo[4.2.0]octa-1(8),6-dien-4-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 123498082 |
| Molecular Formula | C16H12F6N3O2+ |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-[8-(trifluoromethyl)-4,7-diaza-1-azoniabicyclo[4.2.0]octa-1(8),6-dien-4-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
| SMILES | O=C(CC(=O)N1CC[N+]2=C(C(F)(F)F)N=C2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H12F6N3O2/c17-10-6-12(19)11(18)4-8(10)3-9(26)5-14(27)24-1-2-25-13(7-24)23-15(25)16(20,21)22/h4,6H,1-3,5,7H2/q+1 |
| InChIKey | HFKSBGNQJAEYEN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|