C16H13F5N4O2 — CID 156627214
1-[3-(difluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione (PubChem CID 156627214) has the molecular formula C16H13F5N4O2 and a molecular weight of 388.30 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione.
| Compound Name | 1-[3-(difluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 156627214 |
| Molecular Formula | C16H13F5N4O2 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-[3-(difluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
| SMILES | O=C(CC(=O)N1CCn2c(nnc2C(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H13F5N4O2/c17-10-6-12(19)11(18)4-8(10)3-9(26)5-14(27)24-1-2-25-13(7-24)22-23-16(25)15(20)21/h4,6,15H,1-3,5,7H2 |
| InChIKey | NHQVZPIXHCYFMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|