C30H33ClFN3O9 — CID 123498273
1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate (PubChem CID 123498273) has the molecular formula C30H33ClFN3O9 and a molecular weight of 634.06 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 123498273 |
| Molecular Formula | C30H33ClFN3O9 |
| Molecular Weight | 634.06 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoate |
| SMILES | COc1cc(C(=O)NN(Cc2ccc(-c3cc(Cl)ccc3F)cc2)CC(O)C(=O)OC(C)OC(=O)OC2CCCCC2)on1 |
| InChI | InChI=1S/C30H33ClFN3O9/c1-18(42-30(39)43-22-6-4-3-5-7-22)41-29(38)25(36)17-35(33-28(37)26-15-27(40-2)34-44-26)16-19-8-10-20(11-9-19)23-14-21(31)12-13-24(23)32/h8-15,18,22,25,36H,3-7,16-17H2,1-2H3,(H,33,37) |
| InChIKey | LVKAYLUSTSLVMY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 149.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.06 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|