C10H27N3Si — CID 123500695
1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-4-silylbutane-1,1,1-triamine (PubChem CID 123500695) has the molecular formula C10H27N3Si and a molecular weight of 217.43 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-4-silylbutane-1,1,1-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-4-silylbutane-1,1,1-triamine |
|---|---|
| PubChem CID | 123500695 |
| Molecular Formula | C10H27N3Si |
| Molecular Weight | 217.43 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-4-silylbutane-1,1,1-triamine |
| SMILES | CN(C)C(CCC[SiH3])(N(C)C)N(C)C |
| InChI | InChI=1S/C10H27N3Si/c1-11(2)10(12(3)4,13(5)6)8-7-9-14/h7-9H2,1-6,14H3 |
| InChIKey | SOJNWPWWCZAMMJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|