C25H39N — CID 123504158
N-butyl-3-ethylidene-5,8-dimethyl-6-methylidene-N-propyltrideca-1,4,7,9,12-pentaen-2-amine (PubChem CID 123504158) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is N-butyl-3-ethylidene-5,8-dimethyl-6-methylidene-N-propyltrideca-1,4,7,9,12-pentaen-2-amine.
| Compound Name | N-butyl-3-ethylidene-5,8-dimethyl-6-methylidene-N-propyltrideca-1,4,7,9,12-pentaen-2-amine |
|---|---|
| PubChem CID | 123504158 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | N-butyl-3-ethylidene-5,8-dimethyl-6-methylidene-N-propyltrideca-1,4,7,9,12-pentaen-2-amine |
| SMILES | C=CCC=CC(C)=CC(=C)C(C)=CC(=CC)C(=C)N(CCC)CCCC |
| InChI | InChI=1S/C25H39N/c1-9-13-15-16-21(5)19-22(6)23(7)20-25(12-4)24(8)26(17-11-3)18-14-10-2/h9,12,15-16,19-20H,1,6,8,10-11,13-14,17-18H2,2-5,7H3 |
| InChIKey | XAWKSHDZMATKFH-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|