C46H46N2 — CID 11239022
7-N,7-N,20-N,20-N-tetrabutyltetracyclo[24.2.2.04,9.018,23]triaconta-1,2,3,5,7,9,10,11,12,13,14,15,16,17,19,21,23,24,25,27,29-henicosaene-7,20-diamine (PubChem CID 11239022) has the molecular formula C46H46N2 and a molecular weight of 626.89 g/mol. Its IUPAC name is 7-N,7-N,20-N,20-N-tetrabutyltetracyclo[24.2.2.04,9.018,23]triaconta-1,2,3,5,7,9,10,11,12,13,14,15,16,17,19,21,23,24,25,27,29-henicosaene-7,20-diamine.
| Compound Name | 7-N,7-N,20-N,20-N-tetrabutyltetracyclo[24.2.2.04,9.018,23]triaconta-1,2,3,5,7,9,10,11,12,13,14,15,16,17,19,21,23,24,25,27,29-henicosaene-7,20-diamine |
|---|---|
| PubChem CID | 11239022 |
| Molecular Formula | C46H46N2 |
| Molecular Weight | 626.89 g/mol |
| Exact Mass | 626.37 |
| IUPAC Name | 7-N,7-N,20-N,20-N-tetrabutyltetracyclo[24.2.2.04,9.018,23]triaconta-1,2,3,5,7,9,10,11,12,13,14,15,16,17,19,21,23,24,25,27,29-henicosaene-7,20-diamine |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)=C=C=C=C=C=C=C=C=c1cc(N(CCCC)CCCC)ccc1=C=C=c1ccc(cc1)=C=C=2 |
| InChI | InChI=1S/C46H46N2/c1-5-9-33-47(34-10-6-2)45-31-29-41-27-25-39-21-23-40(24-22-39)26-28-42-30-32-46(48(35-11-7-3)36-12-8-4)38-44(42)20-18-16-14-13-15-17-19-43(41)37-45/h21-24,29-32,37-38H,5-12,33-36H2,1-4H3 |
| InChIKey | IGIBOTYZROOKPC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |