C20H16ClN3O2S — CID 123509252
(12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(3-hydroxypyrrolidin-1-yl)methanone (PubChem CID 123509252) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is (12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(3-hydroxypyrrolidin-1-yl)methanone.
| Compound Name | (12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(3-hydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 123509252 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(3-hydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)-c1cc(Cl)c3cccnc3c1NS2)N1CCC(O)C1 |
| InChI | InChI=1S/C20H16ClN3O2S/c21-16-9-15-14-8-11(20(26)24-7-5-12(25)10-24)3-4-17(14)27-23-19(15)18-13(16)2-1-6-22-18/h1-4,6,8-9,12,23,25H,5,7,10H2 |
| InChIKey | POMOTGXHANPMCH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|