C21H19ClN4OS — CID 126516719
(12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 126516719) has the molecular formula C21H19ClN4OS and a molecular weight of 410.93 g/mol. Its IUPAC name is (12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 126516719 |
| Molecular Formula | C21H19ClN4OS |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (12-chloro-5H-quinolino[8,7-c][1,2]benzothiazin-9-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)-c2cc(Cl)c4cccnc4c2NS3)CC1 |
| InChI | InChI=1S/C21H19ClN4OS/c1-25-7-9-26(10-8-25)21(27)13-4-5-18-15(11-13)16-12-17(22)14-3-2-6-23-19(14)20(16)24-28-18/h2-6,11-12,24H,7-10H2,1H3 |
| InChIKey | HEOCWKULAIMDDY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|