C8H18N4O8S2 — CID 123510520
1-[(1-acetamido-2-sulfoethyl)amino]-2-[carbamoyl(methyl)amino]ethanesulfonic acid (PubChem CID 123510520) has the molecular formula C8H18N4O8S2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-[(1-acetamido-2-sulfoethyl)amino]-2-[carbamoyl(methyl)amino]ethanesulfonic acid.
| Compound Name | 1-[(1-acetamido-2-sulfoethyl)amino]-2-[carbamoyl(methyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 123510520 |
| Molecular Formula | C8H18N4O8S2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[(1-acetamido-2-sulfoethyl)amino]-2-[carbamoyl(methyl)amino]ethanesulfonic acid |
| SMILES | CC(=O)NC(CS(=O)(=O)O)NC(CN(C)C(N)=O)S(=O)(=O)O |
| InChI | InChI=1S/C8H18N4O8S2/c1-5(13)10-6(4-21(15,16)17)11-7(22(18,19)20)3-12(2)8(9)14/h6-7,11H,3-4H2,1-2H3,(H2,9,14)(H,10,13)(H,15,16,17)(H,18,19,20) |
| InChIKey | OEGZTXSUZLPCPM-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|