C8H18N4O8S2 — CID 87196616
1-[(1-acetamido-2-sulfoethyl)amino]-2-[(2-amino-2-oxoethyl)amino]ethanesulfonic acid (PubChem CID 87196616) has the molecular formula C8H18N4O8S2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-[(1-acetamido-2-sulfoethyl)amino]-2-[(2-amino-2-oxoethyl)amino]ethanesulfonic acid.
| Compound Name | 1-[(1-acetamido-2-sulfoethyl)amino]-2-[(2-amino-2-oxoethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87196616 |
| Molecular Formula | C8H18N4O8S2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[(1-acetamido-2-sulfoethyl)amino]-2-[(2-amino-2-oxoethyl)amino]ethanesulfonic acid |
| SMILES | CC(=O)NC(CS(=O)(=O)O)NC(CNCC(N)=O)S(=O)(=O)O |
| InChI | InChI=1S/C8H18N4O8S2/c1-5(13)11-7(4-21(15,16)17)12-8(22(18,19)20)3-10-2-6(9)14/h7-8,10,12H,2-4H2,1H3,(H2,9,14)(H,11,13)(H,15,16,17)(H,18,19,20) |
| InChIKey | UALLPJSQIQFYEU-UHFFFAOYSA-N |
| XLogP | -3.79 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|