C5H13N2O5S+ — CID 161312374
[3-[(2-amino-2-oxoethyl)amino]-2-hydroxypropyl]sulfonyloxidanium (PubChem CID 161312374) has the molecular formula C5H13N2O5S+ and a molecular weight of 213.23 g/mol. Its IUPAC name is [3-[(2-amino-2-oxoethyl)amino]-2-hydroxypropyl]sulfonyloxidanium.
| Compound Name | [3-[(2-amino-2-oxoethyl)amino]-2-hydroxypropyl]sulfonyloxidanium |
|---|---|
| PubChem CID | 161312374 |
| Molecular Formula | C5H13N2O5S+ |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | [3-[(2-amino-2-oxoethyl)amino]-2-hydroxypropyl]sulfonyloxidanium |
| SMILES | NC(=O)CNCC(O)CS(=O)(=O)[OH2+] |
| InChI | InChI=1S/C5H12N2O5S/c6-5(9)2-7-1-4(8)3-13(10,11)12/h4,7-8H,1-3H2,(H2,6,9)(H,10,11,12)/p+1 |
| InChIKey | VJBFQTTWFBCMEQ-UHFFFAOYSA-O |
| XLogP | -3.52 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|