C21H37N3O — CID 123514093
3-cyclohexyl-1-ethyl-1-[1-(2-ethylidenehex-3-enyl)pyrrolidin-3-yl]urea (PubChem CID 123514093) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is 3-cyclohexyl-1-ethyl-1-[1-(2-ethylidenehex-3-enyl)pyrrolidin-3-yl]urea.
| Compound Name | 3-cyclohexyl-1-ethyl-1-[1-(2-ethylidenehex-3-enyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 123514093 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | 3-cyclohexyl-1-ethyl-1-[1-(2-ethylidenehex-3-enyl)pyrrolidin-3-yl]urea |
| SMILES | CC=C(C=CCC)CN1CCC(N(CC)C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C21H37N3O/c1-4-7-11-18(5-2)16-23-15-14-20(17-23)24(6-3)21(25)22-19-12-9-8-10-13-19/h5,7,11,19-20H,4,6,8-10,12-17H2,1-3H3,(H,22,25) |
| InChIKey | HEPWAMWYMUNQFY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|