C15H12BrNO2 — CID 123530884
(5S)-3-bromo-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 123530884) has the molecular formula C15H12BrNO2 and a molecular weight of 318.17 g/mol. Its IUPAC name is (5S)-3-bromo-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | (5S)-3-bromo-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 123530884 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (5S)-3-bromo-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | BrC1=C[C@@H](c2ccc(Oc3ccccc3)cc2)ON1 |
| InChI | InChI=1S/C15H12BrNO2/c16-15-10-14(19-17-15)11-6-8-13(9-7-11)18-12-4-2-1-3-5-12/h1-10,14,17H/t14-/m0/s1 |
| InChIKey | HPHPQMHLQGWUFN-AWEZNQCLSA-N |
| XLogP | 4.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|