C20H40O — CID 123533922
8-ethyl-2,2,4,4,8,10,10-heptamethylundec-5-en-1-ol (PubChem CID 123533922) has the molecular formula C20H40O and a molecular weight of 296.54 g/mol. Its IUPAC name is 8-ethyl-2,2,4,4,8,10,10-heptamethylundec-5-en-1-ol.
| Compound Name | 8-ethyl-2,2,4,4,8,10,10-heptamethylundec-5-en-1-ol |
|---|---|
| PubChem CID | 123533922 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 8-ethyl-2,2,4,4,8,10,10-heptamethylundec-5-en-1-ol |
| SMILES | CCC(C)(CC=CC(C)(C)CC(C)(C)CO)CC(C)(C)C |
| InChI | InChI=1S/C20H40O/c1-10-20(9,14-17(2,3)4)13-11-12-18(5,6)15-19(7,8)16-21/h11-12,21H,10,13-16H2,1-9H3 |
| InChIKey | GCASAJYXJBRJSM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|