C20H40O — CID 123375976
2,2,4,4,9,9,11,11-octamethyldodec-7-en-1-ol (PubChem CID 123375976) has the molecular formula C20H40O and a molecular weight of 296.54 g/mol. Its IUPAC name is 2,2,4,4,9,9,11,11-octamethyldodec-7-en-1-ol.
| Compound Name | 2,2,4,4,9,9,11,11-octamethyldodec-7-en-1-ol |
|---|---|
| PubChem CID | 123375976 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 2,2,4,4,9,9,11,11-octamethyldodec-7-en-1-ol |
| SMILES | CC(C)(C)CC(C)(C)C=CCCC(C)(C)CC(C)(C)CO |
| InChI | InChI=1S/C20H40O/c1-17(2,3)14-18(4,5)12-10-11-13-19(6,7)15-20(8,9)16-21/h10,12,21H,11,13-16H2,1-9H3 |
| InChIKey | GDCCBUMPWMXFQM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|