C25H39NO2 — CID 123537546
(4S)-4-propan-2-yl-2-[(2E)-2,6,10,14-tetramethylpentadeca-2,5,9,13-tetraenyl]-4H-1,3-oxazol-5-one (PubChem CID 123537546) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is (4S)-4-propan-2-yl-2-[(2E)-2,6,10,14-tetramethylpentadeca-2,5,9,13-tetraenyl]-4H-1,3-oxazol-5-one.
| Compound Name | (4S)-4-propan-2-yl-2-[(2E)-2,6,10,14-tetramethylpentadeca-2,5,9,13-tetraenyl]-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 123537546 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (4S)-4-propan-2-yl-2-[(2E)-2,6,10,14-tetramethylpentadeca-2,5,9,13-tetraenyl]-4H-1,3-oxazol-5-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC/C=C(\C)CC1=N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C25H39NO2/c1-18(2)11-8-12-20(5)13-9-14-21(6)15-10-16-22(7)17-23-26-24(19(3)4)25(27)28-23/h11,13,15-16,19,24H,8-10,12,14,17H2,1-7H3/b20-13?,21-15?,22-16+/t24-/m0/s1 |
| InChIKey | BZZONWMTEJZENM-FMYBOMKJSA-N |
| XLogP | 7.11 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|