C35H41N9O4 — CID 123545049
2-butan-2-yl-4-[4-[4-[4-[[2-(3H-pyridazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 123545049) has the molecular formula C35H41N9O4 and a molecular weight of 651.77 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[2-(3H-pyridazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[2-(3H-pyridazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 123545049 |
| Molecular Formula | C35H41N9O4 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[2-(3H-pyridazin-2-ylmethyl)-2-pyrimidin-5-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(CN6CC=CC=N6)(c6cncnc6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C35H41N9O4/c1-3-27(2)44-34(45)43(26-39-44)31-8-6-29(7-9-31)40-16-18-41(19-17-40)30-10-12-32(13-11-30)46-22-33-23-47-35(48-33,28-20-36-25-37-21-28)24-42-15-5-4-14-38-42/h4-14,20-21,25-27,33H,3,15-19,22-24H2,1-2H3 |
| InChIKey | CRJXGUYLWDJCLI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|