C20H25BrN2O2 — CID 123555111
7-bromo-1,3,3-trimethyl-8-(phenoxymethyl)-4H-quinoxalin-2-one;ethane (PubChem CID 123555111) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 7-bromo-1,3,3-trimethyl-8-(phenoxymethyl)-4H-quinoxalin-2-one;ethane.
| Compound Name | 7-bromo-1,3,3-trimethyl-8-(phenoxymethyl)-4H-quinoxalin-2-one;ethane |
|---|---|
| PubChem CID | 123555111 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 7-bromo-1,3,3-trimethyl-8-(phenoxymethyl)-4H-quinoxalin-2-one;ethane |
| SMILES | CC.CN1C(=O)C(C)(C)Nc2ccc(Br)c(COc3ccccc3)c21 |
| InChI | InChI=1S/C18H19BrN2O2.C2H6/c1-18(2)17(22)21(3)16-13(14(19)9-10-15(16)20-18)11-23-12-7-5-4-6-8-12;1-2/h4-10,20H,11H2,1-3H3;1-2H3 |
| InChIKey | VTYQDEFKLZOEMX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |