C24H25NO2 — CID 123555223
(3,3-dimethylcyclohepta-1,4,6-trien-1-yl) N-(6-ethenylcyclododeca-1,3,5,7,9,11-hexaen-1-yl)carbamate (PubChem CID 123555223) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3,3-dimethylcyclohepta-1,4,6-trien-1-yl) N-(6-ethenylcyclododeca-1,3,5,7,9,11-hexaen-1-yl)carbamate.
| Compound Name | (3,3-dimethylcyclohepta-1,4,6-trien-1-yl) N-(6-ethenylcyclododeca-1,3,5,7,9,11-hexaen-1-yl)carbamate |
|---|---|
| PubChem CID | 123555223 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3,3-dimethylcyclohepta-1,4,6-trien-1-yl) N-(6-ethenylcyclododeca-1,3,5,7,9,11-hexaen-1-yl)carbamate |
| SMILES | C=CC1=CC=CC=C(NC(=O)OC2=CC(C)(C)C=CC=C2)C=CC=CC=C1 |
| InChI | InChI=1S/C24H25NO2/c1-4-20-13-7-5-6-8-15-21(16-10-9-14-20)25-23(26)27-22-17-11-12-18-24(2,3)19-22/h4-19H,1H2,2-3H3,(H,25,26) |
| InChIKey | MIOSAEPYDXSCDM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |