C20H18N2O3 — CID 123557700
1-[4-[4-(furan-3-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine (PubChem CID 123557700) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[4-[4-(furan-3-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine.
| Compound Name | 1-[4-[4-(furan-3-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine |
|---|---|
| PubChem CID | 123557700 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[4-[4-(furan-3-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\[H])c1ccc(Oc2ccc(OCc3ccoc3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c21-11-9-20(22)16-1-3-18(4-2-16)25-19-7-5-17(6-8-19)24-14-15-10-12-23-13-15/h1-8,10-13,21-22H,9,14H2/b21-11+,22-20+ |
| InChIKey | OICQKPWSAYDAIS-KYPJYIKXSA-N |
| XLogP | 5.06 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|