C20H26 — CID 123559285
3,4-dimethyl-5-methylidenehexacyclo[8.7.0.02,8.03,6.011,17.013,16]heptadec-13-ene (PubChem CID 123559285) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 3,4-dimethyl-5-methylidenehexacyclo[8.7.0.02,8.03,6.011,17.013,16]heptadec-13-ene.
| Compound Name | 3,4-dimethyl-5-methylidenehexacyclo[8.7.0.02,8.03,6.011,17.013,16]heptadec-13-ene |
|---|---|
| PubChem CID | 123559285 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 3,4-dimethyl-5-methylidenehexacyclo[8.7.0.02,8.03,6.011,17.013,16]heptadec-13-ene |
| SMILES | C=C1C(C)C2(C)C1CC1CC3C4CC5=CCC5C4C3C12 |
| InChI | InChI=1S/C20H26/c1-9-10(2)20(3)16(9)8-12-7-15-14-6-11-4-5-13(11)17(14)18(15)19(12)20/h4,10,12-19H,1,5-8H2,2-3H3 |
| InChIKey | XKGONAIUSQIPGD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|