C12H15NO2 — CID 123563360
2-[[(1R,3R)-3-(2-hydroxyacetyl)-2,2-dimethylcyclopropyl]methylidene]but-3-enenitrile (PubChem CID 123563360) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[[(1R,3R)-3-(2-hydroxyacetyl)-2,2-dimethylcyclopropyl]methylidene]but-3-enenitrile.
| Compound Name | 2-[[(1R,3R)-3-(2-hydroxyacetyl)-2,2-dimethylcyclopropyl]methylidene]but-3-enenitrile |
|---|---|
| PubChem CID | 123563360 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-[[(1R,3R)-3-(2-hydroxyacetyl)-2,2-dimethylcyclopropyl]methylidene]but-3-enenitrile |
| SMILES | C=CC(C#N)=C[C@@H]1[C@@H](C(=O)CO)C1(C)C |
| InChI | InChI=1S/C12H15NO2/c1-4-8(6-13)5-9-11(10(15)7-14)12(9,2)3/h4-5,9,11,14H,1,7H2,2-3H3/t9-,11+/m1/s1 |
| InChIKey | IFQUCSRSJAFHSS-KOLCDFICSA-N |
| XLogP | 1.46 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|