C17H23BN2O — CID 123575961
4-(1H-azaborinin-2-yl)-N-(3,3-dimethylbutyl)benzamide (PubChem CID 123575961) has the molecular formula C17H23BN2O and a molecular weight of 282.20 g/mol. Its IUPAC name is 4-(1H-azaborinin-2-yl)-N-(3,3-dimethylbutyl)benzamide.
| Compound Name | 4-(1H-azaborinin-2-yl)-N-(3,3-dimethylbutyl)benzamide |
|---|---|
| PubChem CID | 123575961 |
| Molecular Formula | C17H23BN2O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-(1H-azaborinin-2-yl)-N-(3,3-dimethylbutyl)benzamide |
| SMILES | CC(C)(C)CCNC(=O)c1ccc(B2C=CC=CN2)cc1 |
| InChI | InChI=1S/C17H23BN2O/c1-17(2,3)10-13-19-16(21)14-6-8-15(9-7-14)18-11-4-5-12-20-18/h4-9,11-12,20H,10,13H2,1-3H3,(H,19,21) |
| InChIKey | IUENPXUILGRXGA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|