C11H16 — CID 123581981
5-methyltetracyclo[5.2.1.01,6.02,5]decane (PubChem CID 123581981) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 5-methyltetracyclo[5.2.1.01,6.02,5]decane.
| Compound Name | 5-methyltetracyclo[5.2.1.01,6.02,5]decane |
|---|---|
| PubChem CID | 123581981 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 5-methyltetracyclo[5.2.1.01,6.02,5]decane |
| SMILES | CC12CCC1C13CCC(C1)C23 |
| InChI | InChI=1S/C11H16/c1-10-4-3-8(10)11-5-2-7(6-11)9(10)11/h7-9H,2-6H2,1H3 |
| InChIKey | BFVFUNAMOGTBCN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |