C25H27F3N4O3 — CID 123584442
4,5-dioxo-N-(4-phenylcyclohexyl)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 123584442) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is 4,5-dioxo-N-(4-phenylcyclohexyl)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 4,5-dioxo-N-(4-phenylcyclohexyl)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123584442 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4,5-dioxo-N-(4-phenylcyclohexyl)-1-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCC(c2ccccc2)CC1)C1CN(CCNc2ccc(C(F)(F)F)cn2)C(=O)C1=O |
| InChI | InChI=1S/C25H27F3N4O3/c26-25(27,28)18-8-11-21(30-14-18)29-12-13-32-15-20(22(33)24(32)35)23(34)31-19-9-6-17(7-10-19)16-4-2-1-3-5-16/h1-5,8,11,14,17,19-20H,6-7,9-10,12-13,15H2,(H,29,30)(H,31,34) |
| InChIKey | NXJFNSBMWFIQEW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|