C18H19O5+ — CID 123585200
[1-(3,4-dimethoxyphenyl)-1-oxopropan-2-ylidene]-(2-methoxyphenyl)oxidanium (PubChem CID 123585200) has the molecular formula C18H19O5+ and a molecular weight of 315.35 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-1-oxopropan-2-ylidene]-(2-methoxyphenyl)oxidanium.
| Compound Name | [1-(3,4-dimethoxyphenyl)-1-oxopropan-2-ylidene]-(2-methoxyphenyl)oxidanium |
|---|---|
| PubChem CID | 123585200 |
| Molecular Formula | C18H19O5+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-1-oxopropan-2-ylidene]-(2-methoxyphenyl)oxidanium |
| SMILES | COc1ccc(C(=O)/C(C)=[O+]/c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C18H19O5/c1-12(23-16-8-6-5-7-14(16)20-2)18(19)13-9-10-15(21-3)17(11-13)22-4/h5-11H,1-4H3/q+1 |
| InChIKey | UMMPOYZCBLUBFQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|