C21H29BrF3N4O2+ — CID 123586280
1-[(4-bromo-1-hydroxy-3,4-dihydropyridin-1-ium-2-yl)amino]-2-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanol (PubChem CID 123586280) has the molecular formula C21H29BrF3N4O2+ and a molecular weight of 506.39 g/mol. Its IUPAC name is 1-[(4-bromo-1-hydroxy-3,4-dihydropyridin-1-ium-2-yl)amino]-2-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-[(4-bromo-1-hydroxy-3,4-dihydropyridin-1-ium-2-yl)amino]-2-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 123586280 |
| Molecular Formula | C21H29BrF3N4O2+ |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 1-[(4-bromo-1-hydroxy-3,4-dihydropyridin-1-ium-2-yl)amino]-2-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]ethanol |
| SMILES | CCN1CCN(Cc2ccc(CC(O)NC3=[N+](O)C=CC(Br)C3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H28BrF3N4O2/c1-2-27-7-9-28(10-8-27)14-16-4-3-15(11-18(16)21(23,24)25)12-20(30)26-19-13-17(22)5-6-29(19)31/h3-6,11,17,20,30-31H,2,7-10,12-14H2,1H3/p+1 |
| InChIKey | HTQWCYCHIUVFHK-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 61.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|