C30H41N3O8 — CID 123586962
(1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylic acid (PubChem CID 123586962) has the molecular formula C30H41N3O8 and a molecular weight of 571.67 g/mol. Its IUPAC name is (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylic acid.
| Compound Name | (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylic acid |
|---|---|
| PubChem CID | 123586962 |
| Molecular Formula | C30H41N3O8 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | (1R,23S)-23-tert-butyl-18,18-dimethyl-3,21,24-trioxo-2,12,20-trioxa-4,22,25-triazatetracyclo[23.2.1.14,7.06,11]nonacosa-6,8,10,14-tetraene-26-carboxylic acid |
| SMILES | CC1(C)CCC=CCOc2cccc3c2CN(C3)C(=O)O[C@@H]2CC(C(=O)O)N(C2)C(=O)[C@H](C(C)(C)C)NC(=O)OC1 |
| InChI | InChI=1S/C30H41N3O8/c1-29(2,3)24-25(34)33-16-20(14-22(33)26(35)36)41-28(38)32-15-19-10-9-11-23(21(19)17-32)39-13-8-6-7-12-30(4,5)18-40-27(37)31-24/h6,8-11,20,22,24H,7,12-18H2,1-5H3,(H,31,37)(H,35,36)/t20-,22?,24-/m1/s1 |
| InChIKey | CPLIDXDYMKTJNY-YQNXBIPGSA-N |
| XLogP | 4.09 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|